C24H20N4O4 — CID 135911712
methyl 3-[[4-[(2-aminophenyl)carbamoyl]phenyl]iminomethyl]-2-hydroxy-1H-indole-5-carboxylate (PubChem CID 135911712) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is methyl 3-[[4-[(2-aminophenyl)carbamoyl]phenyl]iminomethyl]-2-hydroxy-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[[4-[(2-aminophenyl)carbamoyl]phenyl]iminomethyl]-2-hydroxy-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 135911712 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | methyl 3-[[4-[(2-aminophenyl)carbamoyl]phenyl]iminomethyl]-2-hydroxy-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c(O)c(/C=N/c3ccc(C(=O)Nc4ccccc4N)cc3)c2c1 |
| InChI | InChI=1S/C24H20N4O4/c1-32-24(31)15-8-11-20-17(12-15)18(23(30)27-20)13-26-16-9-6-14(7-10-16)22(29)28-21-5-3-2-4-19(21)25/h2-13,27,30H,25H2,1H3,(H,28,29)/b26-13+ |
| InChIKey | DJWSGVKCFJGGMZ-LGJNPRDNSA-N |
| XLogP | 4.25 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|