C26H21N5O3S — CID 136629464
5-acetyl-N-[4-[[2-hydroxy-3-(1H-pyrazol-5-yliminomethyl)-1H-indol-5-yl]methyl]phenyl]thiophene-2-carboxamide (PubChem CID 136629464) has the molecular formula C26H21N5O3S and a molecular weight of 483.55 g/mol. Its IUPAC name is 5-acetyl-N-[4-[[2-hydroxy-3-(1H-pyrazol-5-yliminomethyl)-1H-indol-5-yl]methyl]phenyl]thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-[4-[[2-hydroxy-3-(1H-pyrazol-5-yliminomethyl)-1H-indol-5-yl]methyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 136629464 |
| Molecular Formula | C26H21N5O3S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 5-acetyl-N-[4-[[2-hydroxy-3-(1H-pyrazol-5-yliminomethyl)-1H-indol-5-yl]methyl]phenyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)Nc2ccc(Cc3ccc4[nH]c(O)c(C=Nc5ccn[nH]5)c4c3)cc2)s1 |
| InChI | InChI=1S/C26H21N5O3S/c1-15(32)22-8-9-23(35-22)26(34)29-18-5-2-16(3-6-18)12-17-4-7-21-19(13-17)20(25(33)30-21)14-27-24-10-11-28-31-24/h2-11,13-14,30,33H,12H2,1H3,(H,28,31)(H,29,34) |
| InChIKey | FBBRAIGFBVLYRO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|