C15H14N4O3S — CID 135606342
N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 135606342) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 135606342 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2c(C)nc3sccn23)c1O |
| InChI | InChI=1S/C15H14N4O3S/c1-9-12(19-6-7-23-15(19)17-9)14(21)18-16-8-10-4-3-5-11(22-2)13(10)20/h3-8,20H,1-2H3,(H,18,21)/b16-8+ |
| InChIKey | SIEIJOXNEKXGJR-LZYBPNLTSA-N |
| XLogP | 2.18 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|