C21H21N5OS — CID 1227652
N-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 1227652) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is N-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 1227652 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | Cc1ccc(-n2c(C)cc(C=NNC(=O)c3c(C)nc4sccn34)c2C)cc1 |
| InChI | InChI=1S/C21H21N5OS/c1-13-5-7-18(8-6-13)26-14(2)11-17(16(26)4)12-22-24-20(27)19-15(3)23-21-25(19)9-10-28-21/h5-12H,1-4H3,(H,24,27) |
| InChIKey | JOWVBMGZPWNFPC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|