C8H8NNaO5S — CID 135606638
sodium (2Z)-2-hydroxyimino-2-(2-hydroxyphenyl)ethanesulfonate (PubChem CID 135606638) has the molecular formula C8H8NNaO5S and a molecular weight of 253.21 g/mol. Its IUPAC name is sodium (2Z)-2-hydroxyimino-2-(2-hydroxyphenyl)ethanesulfonate.
| Compound Name | sodium (2Z)-2-hydroxyimino-2-(2-hydroxyphenyl)ethanesulfonate |
|---|---|
| PubChem CID | 135606638 |
| Molecular Formula | C8H8NNaO5S |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | sodium (2Z)-2-hydroxyimino-2-(2-hydroxyphenyl)ethanesulfonate |
| SMILES | O=S(=O)([O-])C/C(=N\O)c1ccccc1O.[Na+] |
| InChI | InChI=1S/C8H9NO5S.Na/c10-8-4-2-1-3-6(8)7(9-11)5-15(12,13)14;/h1-4,10-11H,5H2,(H,12,13,14);/q;+1/p-1/b9-7+; |
| InChIKey | YFCPYKJLURCBJV-BXTVWIJMSA-M |
| XLogP | -2.88 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|