C12H10N6O2 — CID 135607936
4-[(E)-([1,2,4]triazolo[4,3-b]pyridazin-6-ylhydrazinylidene)methyl]benzene-1,3-diol (PubChem CID 135607936) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 4-[(E)-([1,2,4]triazolo[4,3-b]pyridazin-6-ylhydrazinylidene)methyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-([1,2,4]triazolo[4,3-b]pyridazin-6-ylhydrazinylidene)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135607936 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-[(E)-([1,2,4]triazolo[4,3-b]pyridazin-6-ylhydrazinylidene)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N/Nc2ccc3nncn3n2)c(O)c1 |
| InChI | InChI=1S/C12H10N6O2/c19-9-2-1-8(10(20)5-9)6-13-15-11-3-4-12-16-14-7-18(12)17-11/h1-7,19-20H,(H,15,17)/b13-6+ |
| InChIKey | CPNQZXJTMJFKAR-AWNIVKPZSA-N |
| XLogP | 0.98 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|