C7H7N3O2 — CID 135608460
2-methyl-4H-pyrazolo[1,5-a]pyrimidine-5,7-dione (PubChem CID 135608460) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-methyl-4H-pyrazolo[1,5-a]pyrimidine-5,7-dione.
| Compound Name | 2-methyl-4H-pyrazolo[1,5-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 135608460 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 2-methyl-4H-pyrazolo[1,5-a]pyrimidine-5,7-dione |
| SMILES | Cc1cc2n(n1)C(=O)CC(=O)N2 |
| InChI | InChI=1S/C7H7N3O2/c1-4-2-5-8-6(11)3-7(12)10(5)9-4/h2H,3H2,1H3,(H,8,11) |
| InChIKey | PPOAIFZITAMTFV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|