About 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one
2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one (PubChem CID 135600432) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one.
Analyze 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The IUPAC name of 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one (CID 135600432) is 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one.
What is the SMILES notation for 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The canonical SMILES for 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one is Cc1cc2n(n1)CCC(=O)N2.
What is the InChIKey of 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The InChIKey is ZFDXQOURENRVBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c1-5-4-6-8-7(11)2-3-10(6)9-5/h4H,2-3H2,1H3,(H,8,11).
What are the key properties of 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one?
2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one has a molecular weight of 151.17 g/mol, XLogP of 0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one is sourced from PubChem (CID 135600432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).