C23H27N5O3 — CID 135611653
N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)acetamide (PubChem CID 135611653) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)acetamide.
| Compound Name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)acetamide |
|---|---|
| PubChem CID | 135611653 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[(E)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)Cc2nc3cc(C)c(C)cc3[nH]c2=O)c(O)c1 |
| InChI | InChI=1S/C23H27N5O3/c1-5-28(6-2)17-8-7-16(21(29)11-17)13-24-27-22(30)12-20-23(31)26-19-10-15(4)14(3)9-18(19)25-20/h7-11,13,29H,5-6,12H2,1-4H3,(H,26,31)(H,27,30)/b24-13+ |
| InChIKey | XKEIBTHCHUWGSM-ZMOGYAJESA-N |
| XLogP | 2.78 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|