C20H29N5O — CID 135612241
4-butanimidoyl-2-[[4-(diethylamino)phenyl]methyl]-5-(methylamino)-1H-pyrimidin-6-one (PubChem CID 135612241) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 4-butanimidoyl-2-[[4-(diethylamino)phenyl]methyl]-5-(methylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-butanimidoyl-2-[[4-(diethylamino)phenyl]methyl]-5-(methylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135612241 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 4-butanimidoyl-2-[[4-(diethylamino)phenyl]methyl]-5-(methylamino)-1H-pyrimidin-6-one |
| SMILES | [H]/N=C(\CCC)c1nc(Cc2ccc(N(CC)CC)cc2)[nH]c(=O)c1NC |
| InChI | InChI=1S/C20H29N5O/c1-5-8-16(21)18-19(22-4)20(26)24-17(23-18)13-14-9-11-15(12-10-14)25(6-2)7-3/h9-12,21-22H,5-8,13H2,1-4H3,(H,23,24,26)/b21-16+ |
| InChIKey | PQMNUIXZUIHLTM-LTGZKZEYSA-N |
| XLogP | 3.42 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|