C13H15ClN4O4S — CID 135612617
1-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 135612617) has the molecular formula C13H15ClN4O4S and a molecular weight of 358.81 g/mol. Its IUPAC name is 1-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 135612617 |
| Molecular Formula | C13H15ClN4O4S |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 1-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(/C=N\NC(=S)NC[C@@H]2CCCO2)c1O |
| InChI | InChI=1S/C13H15ClN4O4S/c14-9-4-8(12(19)11(5-9)18(20)21)6-16-17-13(23)15-7-10-2-1-3-22-10/h4-6,10,19H,1-3,7H2,(H2,15,17,23)/b16-6-/t10-/m0/s1 |
| InChIKey | ZGNOBCZKQZQBQQ-KCUAXXGYSA-N |
| XLogP | 1.93 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|