C13H15BrFN3OS — CID 18272725
1-[(E)-(5-bromo-2-fluorophenyl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 18272725) has the molecular formula C13H15BrFN3OS and a molecular weight of 360.25 g/mol. Its IUPAC name is 1-[(E)-(5-bromo-2-fluorophenyl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(E)-(5-bromo-2-fluorophenyl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 18272725 |
| Molecular Formula | C13H15BrFN3OS |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 1-[(E)-(5-bromo-2-fluorophenyl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Fc1ccc(Br)cc1/C=N/NC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C13H15BrFN3OS/c14-10-3-4-12(15)9(6-10)7-17-18-13(20)16-8-11-2-1-5-19-11/h3-4,6-7,11H,1-2,5,8H2,(H2,16,18,20)/b17-7+ |
| InChIKey | OYWMLUOUIKNIRN-REZTVBANSA-N |
| XLogP | 2.57 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|