C18H17N3O — CID 135612968
2-[(1R)-1-(2,3-dihydroindol-1-yl)ethyl]-3H-quinazolin-4-one (PubChem CID 135612968) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[(1R)-1-(2,3-dihydroindol-1-yl)ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1R)-1-(2,3-dihydroindol-1-yl)ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135612968 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[(1R)-1-(2,3-dihydroindol-1-yl)ethyl]-3H-quinazolin-4-one |
| SMILES | C[C@H](c1nc2ccccc2c(=O)[nH]1)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H17N3O/c1-12(21-11-10-13-6-2-5-9-16(13)21)17-19-15-8-4-3-7-14(15)18(22)20-17/h2-9,12H,10-11H2,1H3,(H,19,20,22)/t12-/m1/s1 |
| InChIKey | MMIJTMYNDCPHAV-GFCCVEGCSA-N |
| XLogP | 3.05 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |