C12H11BrN4O3 — CID 135615175
N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-methyl-5-oxo-1,4-dihydropyrazole-3-carboxamide (PubChem CID 135615175) has the molecular formula C12H11BrN4O3 and a molecular weight of 339.15 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-methyl-5-oxo-1,4-dihydropyrazole-3-carboxamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-methyl-5-oxo-1,4-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135615175 |
| Molecular Formula | C12H11BrN4O3 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-methyl-5-oxo-1,4-dihydropyrazole-3-carboxamide |
| SMILES | CC1C(=O)NN=C1C(=O)N/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C12H11BrN4O3/c1-6-10(15-17-11(6)19)12(20)16-14-5-7-4-8(13)2-3-9(7)18/h2-6,18H,1H3,(H,16,20)(H,17,19)/b14-5+ |
| InChIKey | JUUKXMHXBWMAAY-LHHJGKSTSA-N |
| XLogP | 0.73 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|