C25H22FN3O4 — CID 135616534
(E)-3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methoxyethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide (PubChem CID 135616534) has the molecular formula C25H22FN3O4 and a molecular weight of 447.47 g/mol. Its IUPAC name is (E)-3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methoxyethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methoxyethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 135616534 |
| Molecular Formula | C25H22FN3O4 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (E)-3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methoxyethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide |
| SMILES | COCCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)/C=C/c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C25H22FN3O4/c1-32-15-14-29(16-23-27-21-9-5-3-7-19(21)25(31)28-23)24(30)13-11-17-10-12-22(33-17)18-6-2-4-8-20(18)26/h2-13H,14-16H2,1H3,(H,27,28,31)/b13-11+ |
| InChIKey | KERRRESXMYKWSH-ACCUITESSA-N |
| XLogP | 4.01 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|