C20H18FN3O2 — CID 136679817
N-ethyl-3-(2-fluorophenyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide (PubChem CID 136679817) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is N-ethyl-3-(2-fluorophenyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide.
| Compound Name | N-ethyl-3-(2-fluorophenyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 136679817 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-ethyl-3-(2-fluorophenyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)C=Cc1ccccc1F |
| InChI | InChI=1S/C20H18FN3O2/c1-2-24(19(25)12-11-14-7-3-5-9-16(14)21)13-18-22-17-10-6-4-8-15(17)20(26)23-18/h3-12H,2,13H2,1H3,(H,22,23,26) |
| InChIKey | AHXDYBVTRJHOFB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|