C15H25N5O2S2 — CID 135618358
ethyl N-[3-methyl-4-[(E)-C-methyl-N-(3-methylbutylcarbamothioylamino)carbonimidoyl]-1,2-thiazol-5-yl]carbamate (PubChem CID 135618358) has the molecular formula C15H25N5O2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is ethyl N-[3-methyl-4-[(E)-C-methyl-N-(3-methylbutylcarbamothioylamino)carbonimidoyl]-1,2-thiazol-5-yl]carbamate.
| Compound Name | ethyl N-[3-methyl-4-[(E)-C-methyl-N-(3-methylbutylcarbamothioylamino)carbonimidoyl]-1,2-thiazol-5-yl]carbamate |
|---|---|
| PubChem CID | 135618358 |
| Molecular Formula | C15H25N5O2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | ethyl N-[3-methyl-4-[(E)-C-methyl-N-(3-methylbutylcarbamothioylamino)carbonimidoyl]-1,2-thiazol-5-yl]carbamate |
| SMILES | CCOC(=O)Nc1snc(C)c1/C(C)=N/NC(=S)NCCC(C)C |
| InChI | InChI=1S/C15H25N5O2S2/c1-6-22-15(21)17-13-12(11(5)20-24-13)10(4)18-19-14(23)16-8-7-9(2)3/h9H,6-8H2,1-5H3,(H,17,21)(H2,16,19,23)/b18-10+ |
| InChIKey | IWOLVGQNSKARTM-VCHYOVAHSA-N |
| XLogP | 3.25 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|