C16H10N4O3S — CID 135619775
S-(1,3-benzoxazol-2-yl) N-[(2-hydroxy-1H-indol-3-yl)imino]carbamothioate (PubChem CID 135619775) has the molecular formula C16H10N4O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is S-(1,3-benzoxazol-2-yl) N-[(2-hydroxy-1H-indol-3-yl)imino]carbamothioate.
| Compound Name | S-(1,3-benzoxazol-2-yl) N-[(2-hydroxy-1H-indol-3-yl)imino]carbamothioate |
|---|---|
| PubChem CID | 135619775 |
| Molecular Formula | C16H10N4O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | S-(1,3-benzoxazol-2-yl) N-[(2-hydroxy-1H-indol-3-yl)imino]carbamothioate |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccccc12)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H10N4O3S/c21-14-13(9-5-1-2-6-10(9)17-14)19-20-15(22)24-16-18-11-7-3-4-8-12(11)23-16/h1-8,17,21H/b20-19+ |
| InChIKey | KEMFKQCKMQHPSU-FMQUCBEESA-N |
| XLogP | 5.01 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|