C18H15Cl2NO2S — CID 135619835
2-[(3,4-dichlorophenyl)methyliminomethyl]-5-ethoxy-1-benzothiophen-3-ol (PubChem CID 135619835) has the molecular formula C18H15Cl2NO2S and a molecular weight of 380.30 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyliminomethyl]-5-ethoxy-1-benzothiophen-3-ol.
| Compound Name | 2-[(3,4-dichlorophenyl)methyliminomethyl]-5-ethoxy-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 135619835 |
| Molecular Formula | C18H15Cl2NO2S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyliminomethyl]-5-ethoxy-1-benzothiophen-3-ol |
| SMILES | CCOc1ccc2sc(/C=N/Cc3ccc(Cl)c(Cl)c3)c(O)c2c1 |
| InChI | InChI=1S/C18H15Cl2NO2S/c1-2-23-12-4-6-16-13(8-12)18(22)17(24-16)10-21-9-11-3-5-14(19)15(20)7-11/h3-8,10,22H,2,9H2,1H3/b21-10+ |
| InChIKey | BRFDBEYCWKXPKY-UFFVCSGVSA-N |
| XLogP | 5.93 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|