C20H15ClN4O4S — CID 135621063
2-[(4-chlorophenyl)methylsulfanyl]-5-(4-nitrophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135621063) has the molecular formula C20H15ClN4O4S and a molecular weight of 442.88 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-5-(4-nitrophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-(4-nitrophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135621063 |
| Molecular Formula | C20H15ClN4O4S |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-(4-nitrophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=C1CC(c2ccc([N+](=O)[O-])cc2)c2c(nc(SCc3ccc(Cl)cc3)[nH]c2=O)N1 |
| InChI | InChI=1S/C20H15ClN4O4S/c21-13-5-1-11(2-6-13)10-30-20-23-18-17(19(27)24-20)15(9-16(26)22-18)12-3-7-14(8-4-12)25(28)29/h1-8,15H,9-10H2,(H2,22,23,24,26,27) |
| InChIKey | IBYAKTMTKVYEJY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|