C24H18ClN3O2S — CID 135621156
2-[(4-chlorophenyl)methylsulfanyl]-5-naphthalen-2-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135621156) has the molecular formula C24H18ClN3O2S and a molecular weight of 447.95 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-5-naphthalen-2-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-naphthalen-2-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135621156 |
| Molecular Formula | C24H18ClN3O2S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-5-naphthalen-2-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=C1CC(c2ccc3ccccc3c2)c2c(nc(SCc3ccc(Cl)cc3)[nH]c2=O)N1 |
| InChI | InChI=1S/C24H18ClN3O2S/c25-18-9-5-14(6-10-18)13-31-24-27-22-21(23(30)28-24)19(12-20(29)26-22)17-8-7-15-3-1-2-4-16(15)11-17/h1-11,19H,12-13H2,(H2,26,27,28,29,30) |
| InChIKey | MKEHVBCQBPYGIE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |