C21H17BrFN3O2S — CID 136751920
(5S)-5-(3-bromo-4-fluorophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 136751920) has the molecular formula C21H17BrFN3O2S and a molecular weight of 474.36 g/mol. Its IUPAC name is (5S)-5-(3-bromo-4-fluorophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5S)-5-(3-bromo-4-fluorophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 136751920 |
| Molecular Formula | C21H17BrFN3O2S |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | (5S)-5-(3-bromo-4-fluorophenyl)-2-[(4-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cc1ccc(CSc2nc3c(c(=O)[nH]2)[C@H](c2ccc(F)c(Br)c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C21H17BrFN3O2S/c1-11-2-4-12(5-3-11)10-29-21-25-19-18(20(28)26-21)14(9-17(27)24-19)13-6-7-16(23)15(22)8-13/h2-8,14H,9-10H2,1H3,(H2,24,25,26,27,28)/t14-/m0/s1 |
| InChIKey | ROPOJSOJFUSNQP-AWEZNQCLSA-N |
| XLogP | 4.75 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |