C21H18FN3O4S — CID 136822431
(5S)-2-[(4-fluorophenyl)methylsulfanyl]-5-(4-hydroxy-3-methoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 136822431) has the molecular formula C21H18FN3O4S and a molecular weight of 427.46 g/mol. Its IUPAC name is (5S)-2-[(4-fluorophenyl)methylsulfanyl]-5-(4-hydroxy-3-methoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5S)-2-[(4-fluorophenyl)methylsulfanyl]-5-(4-hydroxy-3-methoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 136822431 |
| Molecular Formula | C21H18FN3O4S |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (5S)-2-[(4-fluorophenyl)methylsulfanyl]-5-(4-hydroxy-3-methoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | COc1cc([C@@H]2CC(=O)Nc3nc(SCc4ccc(F)cc4)[nH]c(=O)c32)ccc1O |
| InChI | InChI=1S/C21H18FN3O4S/c1-29-16-8-12(4-7-15(16)26)14-9-17(27)23-19-18(14)20(28)25-21(24-19)30-10-11-2-5-13(22)6-3-11/h2-8,14,26H,9-10H2,1H3,(H2,23,24,25,27,28)/t14-/m0/s1 |
| InChIKey | FJFJEUHBNMKBFT-AWEZNQCLSA-N |
| XLogP | 3.39 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |