C23H22FN3O5S — CID 135880515
(5S)-2-[(3-fluorophenyl)methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135880515) has the molecular formula C23H22FN3O5S and a molecular weight of 471.51 g/mol. Its IUPAC name is (5S)-2-[(3-fluorophenyl)methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5S)-2-[(3-fluorophenyl)methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135880515 |
| Molecular Formula | C23H22FN3O5S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (5S)-2-[(3-fluorophenyl)methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | COc1cc([C@@H]2CC(=O)Nc3nc(SCc4cccc(F)c4)[nH]c(=O)c32)cc(OC)c1OC |
| InChI | InChI=1S/C23H22FN3O5S/c1-30-16-8-13(9-17(31-2)20(16)32-3)15-10-18(28)25-21-19(15)22(29)27-23(26-21)33-11-12-5-4-6-14(24)7-12/h4-9,15H,10-11H2,1-3H3,(H2,25,26,27,28,29)/t15-/m0/s1 |
| InChIKey | DBLJSUQWOTXDSW-HNNXBMFYSA-N |
| XLogP | 3.70 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |