C22H20FN3O4S — CID 135969182
5-(3-ethoxy-4-hydroxyphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135969182) has the molecular formula C22H20FN3O4S and a molecular weight of 441.48 g/mol. Its IUPAC name is 5-(3-ethoxy-4-hydroxyphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(3-ethoxy-4-hydroxyphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135969182 |
| Molecular Formula | C22H20FN3O4S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 5-(3-ethoxy-4-hydroxyphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCOc1cc(C2CC(=O)Nc3nc(SCc4ccc(F)cc4)[nH]c(=O)c32)ccc1O |
| InChI | InChI=1S/C22H20FN3O4S/c1-2-30-17-9-13(5-8-16(17)27)15-10-18(28)24-20-19(15)21(29)26-22(25-20)31-11-12-3-6-14(23)7-4-12/h3-9,15,27H,2,10-11H2,1H3,(H2,24,25,26,28,29) |
| InChIKey | OLQADQLPLLLBEJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |