C25H26N4O5S — CID 135969239
2-[2-ethoxy-4-[2-[(4-methylphenyl)methylsulfanyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-5-yl]phenoxy]acetamide (PubChem CID 135969239) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[2-[(4-methylphenyl)methylsulfanyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-5-yl]phenoxy]acetamide.
| Compound Name | 2-[2-ethoxy-4-[2-[(4-methylphenyl)methylsulfanyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-5-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 135969239 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2-[2-ethoxy-4-[2-[(4-methylphenyl)methylsulfanyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-5-yl]phenoxy]acetamide |
| SMILES | CCOc1cc(C2CC(=O)Nc3nc(SCc4ccc(C)cc4)[nH]c(=O)c32)ccc1OCC(N)=O |
| InChI | InChI=1S/C25H26N4O5S/c1-3-33-19-10-16(8-9-18(19)34-12-20(26)30)17-11-21(31)27-23-22(17)24(32)29-25(28-23)35-13-15-6-4-14(2)5-7-15/h4-10,17H,3,11-13H2,1-2H3,(H2,26,30)(H2,27,28,29,31,32) |
| InChIKey | DQWZLPJUZFCVGD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |