C25H27N3O4S — CID 135969332
5-(3,4-diethoxyphenyl)-2-[(2-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135969332) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 5-(3,4-diethoxyphenyl)-2-[(2-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(3,4-diethoxyphenyl)-2-[(2-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135969332 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 5-(3,4-diethoxyphenyl)-2-[(2-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCOc1ccc(C2CC(=O)Nc3nc(SCc4ccccc4C)[nH]c(=O)c32)cc1OCC |
| InChI | InChI=1S/C25H27N3O4S/c1-4-31-19-11-10-16(12-20(19)32-5-2)18-13-21(29)26-23-22(18)24(30)28-25(27-23)33-14-17-9-7-6-8-15(17)3/h6-12,18H,4-5,13-14H2,1-3H3,(H2,26,27,28,29,30) |
| InChIKey | VRXRNUYQRNFTQG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |