C24H24N4O5S — CID 135969297
2-[2-methoxy-4-[2-[(2-methylphenyl)methylsulfanyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-5-yl]phenoxy]acetamide (PubChem CID 135969297) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is 2-[2-methoxy-4-[2-[(2-methylphenyl)methylsulfanyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-5-yl]phenoxy]acetamide.
| Compound Name | 2-[2-methoxy-4-[2-[(2-methylphenyl)methylsulfanyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-5-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 135969297 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-[2-methoxy-4-[2-[(2-methylphenyl)methylsulfanyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-5-yl]phenoxy]acetamide |
| SMILES | COc1cc(C2CC(=O)Nc3nc(SCc4ccccc4C)[nH]c(=O)c32)ccc1OCC(N)=O |
| InChI | InChI=1S/C24H24N4O5S/c1-13-5-3-4-6-15(13)12-34-24-27-22-21(23(31)28-24)16(10-20(30)26-22)14-7-8-17(18(9-14)32-2)33-11-19(25)29/h3-9,16H,10-12H2,1-2H3,(H2,25,29)(H2,26,27,28,30,31) |
| InChIKey | CVPSWHVBJICBEK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |