C20H16ClN3O4S — CID 136909912
(5R)-2-[(3-chlorophenyl)methylsulfanyl]-5-(3,4-dihydroxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 136909912) has the molecular formula C20H16ClN3O4S and a molecular weight of 429.89 g/mol. Its IUPAC name is (5R)-2-[(3-chlorophenyl)methylsulfanyl]-5-(3,4-dihydroxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5R)-2-[(3-chlorophenyl)methylsulfanyl]-5-(3,4-dihydroxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 136909912 |
| Molecular Formula | C20H16ClN3O4S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | (5R)-2-[(3-chlorophenyl)methylsulfanyl]-5-(3,4-dihydroxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=C1C[C@H](c2ccc(O)c(O)c2)c2c(nc(SCc3cccc(Cl)c3)[nH]c2=O)N1 |
| InChI | InChI=1S/C20H16ClN3O4S/c21-12-3-1-2-10(6-12)9-29-20-23-18-17(19(28)24-20)13(8-16(27)22-18)11-4-5-14(25)15(26)7-11/h1-7,13,25-26H,8-9H2,(H2,22,23,24,27,28)/t13-/m1/s1 |
| InChIKey | VYYQEUBWHKPJDU-CYBMUJFWSA-N |
| XLogP | 3.60 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|