C13H17NO2 — CID 135621481
2-tert-butyl-4-(4,5-dihydro-1,3-oxazol-2-yl)phenol (PubChem CID 135621481) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-tert-butyl-4-(4,5-dihydro-1,3-oxazol-2-yl)phenol.
| Compound Name | 2-tert-butyl-4-(4,5-dihydro-1,3-oxazol-2-yl)phenol |
|---|---|
| PubChem CID | 135621481 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-tert-butyl-4-(4,5-dihydro-1,3-oxazol-2-yl)phenol |
| SMILES | CC(C)(C)c1cc(C2=NCCO2)ccc1O |
| InChI | InChI=1S/C13H17NO2/c1-13(2,3)10-8-9(4-5-11(10)15)12-14-6-7-16-12/h4-5,8,15H,6-7H2,1-3H3 |
| InChIKey | CYZVXPYZQJXPKW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |