C15H15F2N3O3S — CID 135622543
2-(3,4-difluorophenyl)-6-ethylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135622543) has the molecular formula C15H15F2N3O3S and a molecular weight of 355.37 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-6-ethylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(3,4-difluorophenyl)-6-ethylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135622543 |
| Molecular Formula | C15H15F2N3O3S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-(3,4-difluorophenyl)-6-ethylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCS(=O)(=O)N1CCc2nc(-c3ccc(F)c(F)c3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C15H15F2N3O3S/c1-2-24(22,23)20-6-5-13-10(8-20)15(21)19-14(18-13)9-3-4-11(16)12(17)7-9/h3-4,7H,2,5-6,8H2,1H3,(H,18,19,21) |
| InChIKey | RJBAIKLZUIDFDI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |