C14H12N4O4 — CID 135622810
(5R)-2-amino-5-(1,3-benzodioxol-5-yl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135622810) has the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. Its IUPAC name is (5R)-2-amino-5-(1,3-benzodioxol-5-yl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5R)-2-amino-5-(1,3-benzodioxol-5-yl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135622810 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (5R)-2-amino-5-(1,3-benzodioxol-5-yl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Nc1nc2c(c(=O)[nH]1)[C@@H](c1ccc3c(c1)OCO3)CC(=O)N2 |
| InChI | InChI=1S/C14H12N4O4/c15-14-17-12-11(13(20)18-14)7(4-10(19)16-12)6-1-2-8-9(3-6)22-5-21-8/h1-3,7H,4-5H2,(H4,15,16,17,18,19,20)/t7-/m1/s1 |
| InChIKey | VGKORTWRSRSTNW-SSDOTTSWSA-N |
| XLogP | 0.55 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |