C22H19N3O4S — CID 135880554
(5R)-5-(1,3-benzodioxol-5-yl)-2-[(3-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135880554) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is (5R)-5-(1,3-benzodioxol-5-yl)-2-[(3-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5R)-5-(1,3-benzodioxol-5-yl)-2-[(3-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135880554 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (5R)-5-(1,3-benzodioxol-5-yl)-2-[(3-methylphenyl)methylsulfanyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cc1cccc(CSc2nc3c(c(=O)[nH]2)[C@@H](c2ccc4c(c2)OCO4)CC(=O)N3)c1 |
| InChI | InChI=1S/C22H19N3O4S/c1-12-3-2-4-13(7-12)10-30-22-24-20-19(21(27)25-22)15(9-18(26)23-20)14-5-6-16-17(8-14)29-11-28-16/h2-8,15H,9-11H2,1H3,(H2,23,24,25,26,27)/t15-/m1/s1 |
| InChIKey | SYRNCKDBOIPFRL-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |