C23H27N3O3 — CID 135624630
2-(4-methoxyphenyl)-4-[N-[(3-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-5-propyl-1H-pyrazol-3-one (PubChem CID 135624630) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-[N-[(3-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-5-propyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-methoxyphenyl)-4-[N-[(3-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-5-propyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135624630 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-[N-[(3-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-5-propyl-1H-pyrazol-3-one |
| SMILES | CCCc1[nH]n(-c2ccc(OC)cc2)c(=O)c1/C(C)=N/Cc1cccc(OC)c1 |
| InChI | InChI=1S/C23H27N3O3/c1-5-7-21-22(16(2)24-15-17-8-6-9-20(14-17)29-4)23(27)26(25-21)18-10-12-19(28-3)13-11-18/h6,8-14,25H,5,7,15H2,1-4H3/b24-16+ |
| InChIKey | ZQUXHFQTRCLNSC-LFVJCYFKSA-N |
| XLogP | 4.14 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|