C21H21Cl2N3O2 — CID 135728003
4-[N-(2,5-dichlorophenyl)-C-methylcarbonimidoyl]-2-(4-methoxyphenyl)-5-propyl-1H-pyrazol-3-one (PubChem CID 135728003) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is 4-[N-(2,5-dichlorophenyl)-C-methylcarbonimidoyl]-2-(4-methoxyphenyl)-5-propyl-1H-pyrazol-3-one.
| Compound Name | 4-[N-(2,5-dichlorophenyl)-C-methylcarbonimidoyl]-2-(4-methoxyphenyl)-5-propyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135728003 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 4-[N-(2,5-dichlorophenyl)-C-methylcarbonimidoyl]-2-(4-methoxyphenyl)-5-propyl-1H-pyrazol-3-one |
| SMILES | CCCc1[nH]n(-c2ccc(OC)cc2)c(=O)c1/C(C)=N/c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-4-5-18-20(13(2)24-19-12-14(22)6-11-17(19)23)21(27)26(25-18)15-7-9-16(28-3)10-8-15/h6-12,25H,4-5H2,1-3H3/b24-13+ |
| InChIKey | YMIMKWYLBUKUHE-ZMOGYAJESA-N |
| XLogP | 5.57 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|