C19H15N3O3 — CID 135634342
2-[2-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]benzene-1,4-diol (PubChem CID 135634342) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]benzene-1,4-diol.
| Compound Name | 2-[2-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 135634342 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]benzene-1,4-diol |
| SMILES | COc1ccc(-c2cc3nccc(-c4cc(O)ccc4O)n3n2)cc1 |
| InChI | InChI=1S/C19H15N3O3/c1-25-14-5-2-12(3-6-14)16-11-19-20-9-8-17(22(19)21-16)15-10-13(23)4-7-18(15)24/h2-11,23-24H,1H3 |
| InChIKey | YRHXPUOICDLRBT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|