C23H20N4O6 — CID 46502863
ethyl 2-[2-[2-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-4-nitrophenoxy]acetate (PubChem CID 46502863) has the molecular formula C23H20N4O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is ethyl 2-[2-[2-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-4-nitrophenoxy]acetate.
| Compound Name | ethyl 2-[2-[2-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-4-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 46502863 |
| Molecular Formula | C23H20N4O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | ethyl 2-[2-[2-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]-4-nitrophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc([N+](=O)[O-])cc1-c1ccnc2cc(-c3ccc(OC)cc3)nn12 |
| InChI | InChI=1S/C23H20N4O6/c1-3-32-23(28)14-33-21-9-6-16(27(29)30)12-18(21)20-10-11-24-22-13-19(25-26(20)22)15-4-7-17(31-2)8-5-15/h4-13H,3,14H2,1-2H3 |
| InChIKey | VLZLKCDVKYSDQQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|