C25H27NO5 — CID 135638858
2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]-N-(2-naphthalen-2-ylethyl)acetamide (PubChem CID 135638858) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]-N-(2-naphthalen-2-ylethyl)acetamide.
| Compound Name | 2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]-N-(2-naphthalen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 135638858 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]-N-(2-naphthalen-2-ylethyl)acetamide |
| SMILES | Cc1cc(=O)c(O)c(C2(CC(=O)NCCc3ccc4ccccc4c3)CCOCC2)o1 |
| InChI | InChI=1S/C25H27NO5/c1-17-14-21(27)23(29)24(31-17)25(9-12-30-13-10-25)16-22(28)26-11-8-18-6-7-19-4-2-3-5-20(19)15-18/h2-7,14-15,29H,8-13,16H2,1H3,(H,26,28) |
| InChIKey | HAXWNNGNCDNBJC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |