C17H25NO7 — CID 135638732
N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]acetamide (PubChem CID 135638732) has the molecular formula C17H25NO7 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]acetamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 135638732 |
| Molecular Formula | C17H25NO7 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]acetamide |
| SMILES | COC(CNC(=O)CC1(c2oc(C)cc(=O)c2O)CCOCC1)OC |
| InChI | InChI=1S/C17H25NO7/c1-11-8-12(19)15(21)16(25-11)17(4-6-24-7-5-17)9-13(20)18-10-14(22-2)23-3/h8,14,21H,4-7,9-10H2,1-3H3,(H,18,20) |
| InChIKey | YNSFEVBQAFUWRP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|