C30H40N2O5 — CID 135638991
3-[(10R,13R)-10-[(E)-(benzylhydrazinylidene)methyl]-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one (PubChem CID 135638991) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is 3-[(10R,13R)-10-[(E)-(benzylhydrazinylidene)methyl]-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one.
| Compound Name | 3-[(10R,13R)-10-[(E)-(benzylhydrazinylidene)methyl]-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 135638991 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | 3-[(10R,13R)-10-[(E)-(benzylhydrazinylidene)methyl]-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| SMILES | C[C@]12CCC3C(CCC4(O)CC(O)CC[C@]34/C=N/NCc3ccccc3)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C30H40N2O5/c1-27-11-8-24-25(30(27,36)14-10-23(27)21-15-26(34)37-18-21)9-13-29(35)16-22(33)7-12-28(24,29)19-32-31-17-20-5-3-2-4-6-20/h2-6,15,19,22-25,31,33,35-36H,7-14,16-18H2,1H3/b32-19+/t22?,23?,24?,25?,27-,28+,29?,30?/m1/s1 |
| InChIKey | FYUXEMMUHOXKDQ-XFJMTORISA-N |
| XLogP | 3.47 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|