C29H38N2O5 — CID 45107110
3-[(3R,8R,9S)-3,5,14-trihydroxy-13-methyl-10-[(E)-(phenylhydrazinylidene)methyl]-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one (PubChem CID 45107110) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is 3-[(3R,8R,9S)-3,5,14-trihydroxy-13-methyl-10-[(E)-(phenylhydrazinylidene)methyl]-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one.
| Compound Name | 3-[(3R,8R,9S)-3,5,14-trihydroxy-13-methyl-10-[(E)-(phenylhydrazinylidene)methyl]-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 45107110 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 3-[(3R,8R,9S)-3,5,14-trihydroxy-13-methyl-10-[(E)-(phenylhydrazinylidene)methyl]-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| SMILES | CC12CC[C@H]3[C@@H](CCC4(O)C[C@H](O)CCC34/C=N/Nc3ccccc3)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C29H38N2O5/c1-26-11-8-23-24(29(26,35)14-10-22(26)19-15-25(33)36-17-19)9-13-28(34)16-21(32)7-12-27(23,28)18-30-31-20-5-3-2-4-6-20/h2-6,15,18,21-24,31-32,34-35H,7-14,16-17H2,1H3/b30-18+/t21-,22?,23+,24-,26?,27?,28?,29?/m1/s1 |
| InChIKey | XQYWJIDANYBAFF-BXDGXKOCSA-N |
| XLogP | 3.80 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|