C33H36N6O4 — CID 135639899
(2S,3R)-N-[5-(1-methylbenzimidazol-2-yl)pentyl]-7-nitro-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaene-3-carboxamide (PubChem CID 135639899) has the molecular formula C33H36N6O4 and a molecular weight of 580.69 g/mol. Its IUPAC name is (2S,3R)-N-[5-(1-methylbenzimidazol-2-yl)pentyl]-7-nitro-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaene-3-carboxamide.
| Compound Name | (2S,3R)-N-[5-(1-methylbenzimidazol-2-yl)pentyl]-7-nitro-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaene-3-carboxamide |
|---|---|
| PubChem CID | 135639899 |
| Molecular Formula | C33H36N6O4 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | (2S,3R)-N-[5-(1-methylbenzimidazol-2-yl)pentyl]-7-nitro-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaene-3-carboxamide |
| SMILES | Cn1c(CCCCCNC(=O)[C@@H]2Cc3cc([N+](=O)[O-])ccc3N3CC4CC(Cn5c4cccc5=O)[C@@H]23)nc2ccccc21 |
| InChI | InChI=1S/C33H36N6O4/c1-36-29-9-5-4-8-26(29)35-30(36)11-3-2-6-15-34-33(41)25-18-21-17-24(39(42)43)13-14-28(21)38-19-22-16-23(32(25)38)20-37-27(22)10-7-12-31(37)40/h4-5,7-10,12-14,17,22-23,25,32H,2-3,6,11,15-16,18-20H2,1H3,(H,34,41)/t22?,23?,25-,32+/m1/s1 |
| InChIKey | ORGURDQIIVWFAM-VKLNODTKSA-N |
| XLogP | 4.34 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|