C30H34N4O6 — CID 163147167
(2S,3R)-3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]-N-hydroxy-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaen-7-amine oxide (PubChem CID 163147167) has the molecular formula C30H34N4O6 and a molecular weight of 546.62 g/mol. Its IUPAC name is (2S,3R)-3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]-N-hydroxy-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaen-7-amine oxide.
| Compound Name | (2S,3R)-3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]-N-hydroxy-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaen-7-amine oxide |
|---|---|
| PubChem CID | 163147167 |
| Molecular Formula | C30H34N4O6 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | (2S,3R)-3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]-N-hydroxy-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaen-7-amine oxide |
| SMILES | COc1ccc(CCNC(=O)[C@@H]2Cc3cc([NH+]([O-])O)ccc3N3CC4CC(Cn5c4cccc5=O)[C@@H]23)cc1OC |
| InChI | InChI=1S/C30H34N4O6/c1-39-26-9-6-18(12-27(26)40-2)10-11-31-30(36)23-15-19-14-22(34(37)38)7-8-25(19)33-16-20-13-21(29(23)33)17-32-24(20)4-3-5-28(32)35/h3-9,12,14,20-21,23,29,34,37H,10-11,13,15-17H2,1-2H3,(H,31,36)/t20?,21?,23-,29+/m1/s1 |
| InChIKey | MACOSTMUPNSLHF-CDSGXBBZSA-N |
| XLogP | 1.79 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|