C25H28N4O6S — CID 171153039
(2S,3R)-N-[(1,1-dioxothiolan-3-yl)methyl]-7-nitro-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaene-3-carboxamide (PubChem CID 171153039) has the molecular formula C25H28N4O6S and a molecular weight of 512.59 g/mol. Its IUPAC name is (2S,3R)-N-[(1,1-dioxothiolan-3-yl)methyl]-7-nitro-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaene-3-carboxamide.
| Compound Name | (2S,3R)-N-[(1,1-dioxothiolan-3-yl)methyl]-7-nitro-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaene-3-carboxamide |
|---|---|
| PubChem CID | 171153039 |
| Molecular Formula | C25H28N4O6S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | (2S,3R)-N-[(1,1-dioxothiolan-3-yl)methyl]-7-nitro-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaene-3-carboxamide |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)[C@@H]1Cc2cc([N+](=O)[O-])ccc2N2CC3CC(Cn4c3cccc4=O)[C@@H]12 |
| InChI | InChI=1S/C25H28N4O6S/c30-23-3-1-2-21-17-8-18(13-27(21)23)24-20(25(31)26-11-15-6-7-36(34,35)14-15)10-16-9-19(29(32)33)4-5-22(16)28(24)12-17/h1-5,9,15,17-18,20,24H,6-8,10-14H2,(H,26,31)/t15?,17?,18?,20-,24+/m1/s1 |
| InChIKey | UJBJLYGGJCIKJN-DVXXRQNRSA-N |
| XLogP | 1.47 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|