C38H45NO9 — CID 135640435
3-[(4S,12E)-16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl]-N-[(1S)-1-phenylethyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 135640435) has the molecular formula C38H45NO9 and a molecular weight of 659.78 g/mol. Its IUPAC name is 3-[(4S,12E)-16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl]-N-[(1S)-1-phenylethyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-[(4S,12E)-16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl]-N-[(1S)-1-phenylethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 135640435 |
| Molecular Formula | C38H45NO9 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.31 |
| IUPAC Name | 3-[(4S,12E)-16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl]-N-[(1S)-1-phenylethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(C(CC(=O)N[C@@H](C)c2ccccc2)c2c(O)cc3c(c2O)C(=O)O[C@@H](C)CCCC(=O)CCC/C=C/3)cc(OC)c1OC |
| InChI | InChI=1S/C38H45NO9/c1-23-13-12-18-28(40)17-11-7-10-16-26-19-30(41)35(36(43)34(26)38(44)48-23)29(22-33(42)39-24(2)25-14-8-6-9-15-25)27-20-31(45-3)37(47-5)32(21-27)46-4/h6,8-10,14-16,19-21,23-24,29,41,43H,7,11-13,17-18,22H2,1-5H3,(H,39,42)/b16-10+/t23-,24-,29?/m0/s1 |
| InChIKey | CTPHUKPCPSKUNO-AQDWVJKQSA-N |
| XLogP | 7.00 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |