C32H42N2O11S — CID 163035309
3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-N-(2-sulfamoylethyl)-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 163035309) has the molecular formula C32H42N2O11S and a molecular weight of 662.76 g/mol. Its IUPAC name is 3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-N-(2-sulfamoylethyl)-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-N-(2-sulfamoylethyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 163035309 |
| Molecular Formula | C32H42N2O11S |
| Molecular Weight | 662.76 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | 3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-N-(2-sulfamoylethyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(C(CC(=O)NCCS(N)(=O)=O)c2c(O)cc3c(c2O)C(=O)OC(C)CCCC(=O)CCCC=C3)cc(OC)c1OC |
| InChI | InChI=1S/C32H42N2O11S/c1-19-9-8-12-22(35)11-7-5-6-10-20-15-24(36)29(30(38)28(20)32(39)45-19)23(18-27(37)34-13-14-46(33,40)41)21-16-25(42-2)31(44-4)26(17-21)43-3/h6,10,15-17,19,23,36,38H,5,7-9,11-14,18H2,1-4H3,(H,34,37)(H2,33,40,41) |
| InChIKey | VLPLBFQKXONDGR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 200.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |