C40H46N2O9 — CID 163061948
3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-N-(2-indol-1-ylethyl)-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 163061948) has the molecular formula C40H46N2O9 and a molecular weight of 698.81 g/mol. Its IUPAC name is 3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-N-(2-indol-1-ylethyl)-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-N-(2-indol-1-ylethyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 163061948 |
| Molecular Formula | C40H46N2O9 |
| Molecular Weight | 698.81 g/mol |
| Exact Mass | 698.32 |
| IUPAC Name | 3-(16,18-dihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(18),12,14,16-tetraen-17-yl)-N-(2-indol-1-ylethyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(C(CC(=O)NCCn2ccc3ccccc32)c2c(O)cc3c(c2O)C(=O)OC(C)CCCC(=O)CCCC=C3)cc(OC)c1OC |
| InChI | InChI=1S/C40H46N2O9/c1-25-11-10-15-29(43)14-7-5-6-13-27-21-32(44)37(38(46)36(27)40(47)51-25)30(28-22-33(48-2)39(50-4)34(23-28)49-3)24-35(45)41-18-20-42-19-17-26-12-8-9-16-31(26)42/h6,8-9,12-13,16-17,19,21-23,25,30,44,46H,5,7,10-11,14-15,18,20,24H2,1-4H3,(H,41,45) |
| InChIKey | QBBNNOAYAOKFKD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.81 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |