C14H14N2O5 — CID 135642156
N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]furan-2-carboxamide (PubChem CID 135642156) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 135642156 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]furan-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccco2)cc(OC)c1O |
| InChI | InChI=1S/C14H14N2O5/c1-19-11-6-9(7-12(20-2)13(11)17)8-15-16-14(18)10-4-3-5-21-10/h3-8,17H,1-2H3,(H,16,18)/b15-8+ |
| InChIKey | FCYZGMKRLUTVQJ-OVCLIPMQSA-N |
| XLogP | 1.77 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|