C23H23N5O2S2 — CID 135644902
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 135644902) has the molecular formula C23H23N5O2S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135644902 |
| Molecular Formula | C23H23N5O2S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | COc1ccc(N2CCN(c3nc(CSc4nc5ccccc5s4)cc(=O)[nH]3)CC2)cc1 |
| InChI | InChI=1S/C23H23N5O2S2/c1-30-18-8-6-17(7-9-18)27-10-12-28(13-11-27)22-24-16(14-21(29)26-22)15-31-23-25-19-4-2-3-5-20(19)32-23/h2-9,14H,10-13,15H2,1H3,(H,24,26,29) |
| InChIKey | SPEPPHHQDRLFMM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|