C26H38N6O3 — CID 135933282
2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one (PubChem CID 135933282) has the molecular formula C26H38N6O3 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135933282 |
| Molecular Formula | C26H38N6O3 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one |
| SMILES | COc1ccc(N2CCN(Cc3cc(=O)[nH]c(N4CCN(C(=O)CC(C)(C)C)CC4)n3)CC2)cc1 |
| InChI | InChI=1S/C26H38N6O3/c1-26(2,3)18-24(34)31-13-15-32(16-14-31)25-27-20(17-23(33)28-25)19-29-9-11-30(12-10-29)21-5-7-22(35-4)8-6-21/h5-8,17H,9-16,18-19H2,1-4H3,(H,27,28,33) |
| InChIKey | BDXASROICNNRLL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|